![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/tar.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| xga.tar | 1970-01-01 03:00 | 68K | |
| wd33.tar | 1970-01-01 03:00 | 46K | |
| wd.tar | 1970-01-01 03:00 | 90K | |
| w32.tar | 1970-01-01 03:00 | 52K | |
| tta.tar | 1970-01-01 03:00 | 57K | |
| tms.tar | 1970-01-01 03:00 | 309K | |
| s3.tar | 1970-01-01 03:00 | 112K | |
| qvis.tar | 1970-01-01 03:00 | 67K | |
| p9100.tar | 1970-01-01 03:00 | 76K | |
| p9000.tar | 1970-01-01 03:00 | 90K | |
| nte.tar | 1970-01-01 03:00 | 384K | |
| mw.tar | 1970-01-01 03:00 | 615K | |
| mil.tar | 1970-01-01 03:00 | 66K | |
| mga.tar | 1970-01-01 03:00 | 79K | |
| m32.tar | 1970-01-01 03:00 | 67K | |
| i128.tar | 1970-01-01 03:00 | 83K | |
| gd5426.tar | 1970-01-01 03:00 | 143K | |
| eff.tar | 1970-01-01 03:00 | 110K | |
| cxm.tar | 1970-01-01 03:00 | 64K | |
| ct.tar | 1970-01-01 03:00 | 87K | |
| agx.tar | 1970-01-01 03:00 | 52K | |
| Vidconf.tar | 1970-01-01 03:00 | 2.1M | |
Welcome to my mirror site. Served fresh: updated 4 times a day!
This site supports http and https.
If there are any problems, you should be able to reach me at admin@rqsall.com.
Have a lot of fun...